C13H21N3O — CID 61324339
1-[4-(2,2-dimethylpropylamino)phenyl]-3-methylurea (PubChem CID 61324339) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropylamino)phenyl]-3-methylurea.
| Compound Name | 1-[4-(2,2-dimethylpropylamino)phenyl]-3-methylurea |
|---|---|
| PubChem CID | 61324339 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[4-(2,2-dimethylpropylamino)phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(NCC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H21N3O/c1-13(2,3)9-15-10-5-7-11(8-6-10)16-12(17)14-4/h5-8,15H,9H2,1-4H3,(H2,14,16,17) |
| InChIKey | NBYLFTRAMFCTSM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |