C11H13F3NO+ — CID 58850401
trimethyl-[4-(2,2,2-trifluoroacetyl)phenyl]azanium (PubChem CID 58850401) has the molecular formula C11H13F3NO+ and a molecular weight of 232.22 g/mol. Its IUPAC name is trimethyl-[4-(2,2,2-trifluoroacetyl)phenyl]azanium.
| Compound Name | trimethyl-[4-(2,2,2-trifluoroacetyl)phenyl]azanium |
|---|---|
| PubChem CID | 58850401 |
| Molecular Formula | C11H13F3NO+ |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | trimethyl-[4-(2,2,2-trifluoroacetyl)phenyl]azanium |
| SMILES | C[N+](C)(C)c1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3NO/c1-15(2,3)9-6-4-8(5-7-9)10(16)11(12,13)14/h4-7H,1-3H3/q+1 |
| InChIKey | ZDERDJOLLRDALC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|