C11H11F3O3 — CID 14709558
2,2,2-trifluoro-1-[4-(methoxymethoxymethyl)phenyl]ethanone (PubChem CID 14709558) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(methoxymethoxymethyl)phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(methoxymethoxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 14709558 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(methoxymethoxymethyl)phenyl]ethanone |
| SMILES | COCOCc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O3/c1-16-7-17-6-8-2-4-9(5-3-8)10(15)11(12,13)14/h2-5H,6-7H2,1H3 |
| InChIKey | FLIRXYPMHYOUJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|