C11H12ClNO4 — CID 171868481
3-[4-(2-chloroacetyl)phenyl]-2,3-dihydroxypropanamide (PubChem CID 171868481) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is 3-[4-(2-chloroacetyl)phenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[4-(2-chloroacetyl)phenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868481 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-[4-(2-chloroacetyl)phenyl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(C(=O)CCl)cc1 |
| InChI | InChI=1S/C11H12ClNO4/c12-5-8(14)6-1-3-7(4-2-6)9(15)10(16)11(13)17/h1-4,9-10,15-16H,5H2,(H2,13,17) |
| InChIKey | DYBCTFHJLYLJGU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|