C12H17NO7 — CID 17371099
2,3-dihydroxybutanedioic acid;2-ethyl-6-methylpyridin-3-ol (PubChem CID 17371099) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-ethyl-6-methylpyridin-3-ol.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-ethyl-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 17371099 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-ethyl-6-methylpyridin-3-ol |
| SMILES | CCc1nc(C)ccc1O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C8H11NO.C4H6O6/c1-3-7-8(10)5-4-6(2)9-7;5-1(3(7)8)2(6)4(9)10/h4-5,10H,3H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | LLYGYNICTYXZOX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |