C14H21N3O3 — CID 79158647
2-[4-[(3-hydroxy-6-methyl-2-pyridinyl)methyl]piperazin-1-yl]propanoic acid (PubChem CID 79158647) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[4-[(3-hydroxy-6-methyl-2-pyridinyl)methyl]piperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-[(3-hydroxy-6-methyl-2-pyridinyl)methyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 79158647 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[4-[(3-hydroxy-6-methyl-2-pyridinyl)methyl]piperazin-1-yl]propanoic acid |
| SMILES | Cc1ccc(O)c(CN2CCN(C(C)C(=O)O)CC2)n1 |
| InChI | InChI=1S/C14H21N3O3/c1-10-3-4-13(18)12(15-10)9-16-5-7-17(8-6-16)11(2)14(19)20/h3-4,11,18H,5-9H2,1-2H3,(H,19,20) |
| InChIKey | HGMVXHKDOLFLGM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |