C11H17N3O3 — CID 62312277
2-[4-(1,2-oxazol-4-ylmethyl)piperazin-1-yl]propanoic acid (PubChem CID 62312277) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-[4-(1,2-oxazol-4-ylmethyl)piperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-(1,2-oxazol-4-ylmethyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 62312277 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[4-(1,2-oxazol-4-ylmethyl)piperazin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCN(Cc2cnoc2)CC1 |
| InChI | InChI=1S/C11H17N3O3/c1-9(11(15)16)14-4-2-13(3-5-14)7-10-6-12-17-8-10/h6,8-9H,2-5,7H2,1H3,(H,15,16) |
| InChIKey | DHSIDEKPLLGYRV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |