C10H16N2O — CID 130627037
4-[(4-methylpiperidin-1-yl)methyl]-1,2-oxazole (PubChem CID 130627037) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-[(4-methylpiperidin-1-yl)methyl]-1,2-oxazole.
| Compound Name | 4-[(4-methylpiperidin-1-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 130627037 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-[(4-methylpiperidin-1-yl)methyl]-1,2-oxazole |
| SMILES | CC1CCN(Cc2cnoc2)CC1 |
| InChI | InChI=1S/C10H16N2O/c1-9-2-4-12(5-3-9)7-10-6-11-13-8-10/h6,8-9H,2-5,7H2,1H3 |
| InChIKey | PCXGLSRXICFZHB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |