1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid

C9H12N2O3 — CID 63032730

IUPAC1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(Cc2cnoc2)C1
InChIInChI=1S/C9H12N2O3/c12-9(13)8-1-2-11(5-8)4-7-3-10-14-6-7/h3,6,8H,1-2,4-5H2,(H,12,13)
InChIKeyRWXMEGWAXXUHCW-UHFFFAOYSA-N
MW196.21 g/mol
LogP0.58
Rot. Bonds3

About 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid

1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63032730) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid
PubChem CID63032730
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Name1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(Cc2cnoc2)C1
InChIInChI=1S/C9H12N2O3/c12-9(13)8-1-2-11(5-8)4-7-3-10-14-6-7/h3,6,8H,1-2,4-5H2,(H,12,13)
InChIKeyRWXMEGWAXXUHCW-UHFFFAOYSA-N
XLogP0.58
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid (CID 63032730) is 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(Cc2cnoc2)C1.
What is the InChIKey of 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid?
The InChIKey is RWXMEGWAXXUHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-9(13)8-1-2-11(5-8)4-7-3-10-14-6-7/h3,6,8H,1-2,4-5H2,(H,12,13).
What are the key properties of 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid?
1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-oxazol-4-ylmethyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 63032730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).