C10H14N2O2 — CID 62654197
1-(1,2-oxazol-4-ylmethyl)piperidine-3-carbaldehyde (PubChem CID 62654197) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(1,2-oxazol-4-ylmethyl)piperidine-3-carbaldehyde.
| Compound Name | 1-(1,2-oxazol-4-ylmethyl)piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 62654197 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(1,2-oxazol-4-ylmethyl)piperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(Cc2cnoc2)C1 |
| InChI | InChI=1S/C10H14N2O2/c13-7-9-2-1-3-12(5-9)6-10-4-11-14-8-10/h4,7-9H,1-3,5-6H2 |
| InChIKey | RSBDBPYJLKHUKP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|