C10H14N2O3 — CID 79163527
3-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]propanoic acid (PubChem CID 79163527) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]propanoic acid.
| Compound Name | 3-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 79163527 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]propanoic acid |
| SMILES | Cc1ccc(O)c(CNCCC(=O)O)n1 |
| InChI | InChI=1S/C10H14N2O3/c1-7-2-3-9(13)8(12-7)6-11-5-4-10(14)15/h2-3,11,13H,4-6H2,1H3,(H,14,15) |
| InChIKey | KDZGYTBBMDBIFA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|