C11H18N2O2S — CID 115627139
2-[(2-ethylsulfinylethylamino)methyl]-6-methylpyridin-3-ol (PubChem CID 115627139) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-[(2-ethylsulfinylethylamino)methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[(2-ethylsulfinylethylamino)methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 115627139 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[(2-ethylsulfinylethylamino)methyl]-6-methylpyridin-3-ol |
| SMILES | CCS(=O)CCNCc1nc(C)ccc1O |
| InChI | InChI=1S/C11H18N2O2S/c1-3-16(15)7-6-12-8-10-11(14)5-4-9(2)13-10/h4-5,12,14H,3,6-8H2,1-2H3 |
| InChIKey | MCGZCOVLTRVKOG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|