C10H17N3O3 — CID 171872435
1-(5,6-diamino-2-methyl-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872435) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(5,6-diamino-2-methyl-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(5,6-diamino-2-methyl-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872435 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(5,6-diamino-2-methyl-3-pyridinyl)butane-1,2,4-triol |
| SMILES | Cc1nc(N)c(N)cc1C(O)C(O)CCO |
| InChI | InChI=1S/C10H17N3O3/c1-5-6(4-7(11)10(12)13-5)9(16)8(15)2-3-14/h4,8-9,14-16H,2-3,11H2,1H3,(H2,12,13) |
| InChIKey | OXLJGZFGWOPUEJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |