C11H17NO3 — CID 171872034
1-(2-amino-4-methylphenyl)butane-1,2,4-triol (PubChem CID 171872034) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(2-amino-4-methylphenyl)butane-1,2,4-triol.
| Compound Name | 1-(2-amino-4-methylphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872034 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-(2-amino-4-methylphenyl)butane-1,2,4-triol |
| SMILES | Cc1ccc(C(O)C(O)CCO)c(N)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7-2-3-8(9(12)6-7)11(15)10(14)4-5-13/h2-3,6,10-11,13-15H,4-5,12H2,1H3 |
| InChIKey | YKLVAQSGSIBAOR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|