C10H16N2O2 — CID 170827782
3-amino-1-(2-amino-4-methylphenyl)propane-1,2-diol (PubChem CID 170827782) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-amino-1-(2-amino-4-methylphenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(2-amino-4-methylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827782 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-amino-1-(2-amino-4-methylphenyl)propane-1,2-diol |
| SMILES | Cc1ccc(C(O)C(O)CN)c(N)c1 |
| InChI | InChI=1S/C10H16N2O2/c1-6-2-3-7(8(12)4-6)10(14)9(13)5-11/h2-4,9-10,13-14H,5,11-12H2,1H3 |
| InChIKey | ZKDVRAGCPNCQIY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|