C10H16ClNO — CID 137346924
2-amino-1-(2,4-dimethylphenyl)ethanol;hydrochloride (PubChem CID 137346924) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 2-amino-1-(2,4-dimethylphenyl)ethanol;hydrochloride.
| Compound Name | 2-amino-1-(2,4-dimethylphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 137346924 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-amino-1-(2,4-dimethylphenyl)ethanol;hydrochloride |
| SMILES | Cc1ccc(C(O)CN)c(C)c1.Cl |
| InChI | InChI=1S/C10H15NO.ClH/c1-7-3-4-9(8(2)5-7)10(12)6-11;/h3-5,10,12H,6,11H2,1-2H3;1H |
| InChIKey | ZWLYLJRTIDMALJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |