C12H19NO2 — CID 82313394
1-(2,4-dimethylphenyl)-2-(2-hydroxyethylamino)ethanol (PubChem CID 82313394) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-(2-hydroxyethylamino)ethanol.
| Compound Name | 1-(2,4-dimethylphenyl)-2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 82313394 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-(2-hydroxyethylamino)ethanol |
| SMILES | Cc1ccc(C(O)CNCCO)c(C)c1 |
| InChI | InChI=1S/C12H19NO2/c1-9-3-4-11(10(2)7-9)12(15)8-13-5-6-14/h3-4,7,12-15H,5-6,8H2,1-2H3 |
| InChIKey | HABNAEGPPKWYMF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|