C13H21NO3 — CID 171872717
1-(2-amino-5-propan-2-ylphenyl)butane-1,2,4-triol (PubChem CID 171872717) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-(2-amino-5-propan-2-ylphenyl)butane-1,2,4-triol.
| Compound Name | 1-(2-amino-5-propan-2-ylphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872717 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(2-amino-5-propan-2-ylphenyl)butane-1,2,4-triol |
| SMILES | CC(C)c1ccc(N)c(C(O)C(O)CCO)c1 |
| InChI | InChI=1S/C13H21NO3/c1-8(2)9-3-4-11(14)10(7-9)13(17)12(16)5-6-15/h3-4,7-8,12-13,15-17H,5-6,14H2,1-2H3 |
| InChIKey | CCOJFNXBYBYWRJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|