C9H14N2O2 — CID 142719749
1-(2,5-diaminophenyl)propane-1,2-diol (PubChem CID 142719749) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(2,5-diaminophenyl)propane-1,2-diol.
| Compound Name | 1-(2,5-diaminophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 142719749 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(2,5-diaminophenyl)propane-1,2-diol |
| SMILES | CC(O)C(O)c1cc(N)ccc1N |
| InChI | InChI=1S/C9H14N2O2/c1-5(12)9(13)7-4-6(10)2-3-8(7)11/h2-5,9,12-13H,10-11H2,1H3 |
| InChIKey | BYJIREDBKHAJLD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|