C12H20N2O2 — CID 163709207
1-(2,4-diaminophenyl)-2-methoxy-3-methylbutan-1-ol (PubChem CID 163709207) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2,4-diaminophenyl)-2-methoxy-3-methylbutan-1-ol.
| Compound Name | 1-(2,4-diaminophenyl)-2-methoxy-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 163709207 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-(2,4-diaminophenyl)-2-methoxy-3-methylbutan-1-ol |
| SMILES | COC(C(C)C)C(O)c1ccc(N)cc1N |
| InChI | InChI=1S/C12H20N2O2/c1-7(2)12(16-3)11(15)9-5-4-8(13)6-10(9)14/h4-7,11-12,15H,13-14H2,1-3H3 |
| InChIKey | KHSRHQBXWNBGRQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|