C11H16N2 — CID 13441752
4-[(E)-pent-3-en-2-yl]benzene-1,3-diamine (PubChem CID 13441752) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-[(E)-pent-3-en-2-yl]benzene-1,3-diamine.
| Compound Name | 4-[(E)-pent-3-en-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 13441752 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-[(E)-pent-3-en-2-yl]benzene-1,3-diamine |
| SMILES | C/C=C/C(C)c1ccc(N)cc1N |
| InChI | InChI=1S/C11H16N2/c1-3-4-8(2)10-6-5-9(12)7-11(10)13/h3-8H,12-13H2,1-2H3/b4-3+ |
| InChIKey | PGEYCPOFLJFDQR-ONEGZZNKSA-N |
| XLogP | 2.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|