C11H16ClNO3 — CID 171872317
1-(4-amino-2-chloro-5-methylphenyl)butane-1,2,4-triol (PubChem CID 171872317) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 1-(4-amino-2-chloro-5-methylphenyl)butane-1,2,4-triol.
| Compound Name | 1-(4-amino-2-chloro-5-methylphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872317 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(4-amino-2-chloro-5-methylphenyl)butane-1,2,4-triol |
| SMILES | Cc1cc(C(O)C(O)CCO)c(Cl)cc1N |
| InChI | InChI=1S/C11H16ClNO3/c1-6-4-7(8(12)5-9(6)13)11(16)10(15)2-3-14/h4-5,10-11,14-16H,2-3,13H2,1H3 |
| InChIKey | UJTADARUIFPMND-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|