C10H14ClNO3 — CID 170817875
1-(4-amino-2-chloro-5-methylphenyl)propane-1,2,3-triol (PubChem CID 170817875) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 1-(4-amino-2-chloro-5-methylphenyl)propane-1,2,3-triol.
| Compound Name | 1-(4-amino-2-chloro-5-methylphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817875 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-(4-amino-2-chloro-5-methylphenyl)propane-1,2,3-triol |
| SMILES | Cc1cc(C(O)C(O)CO)c(Cl)cc1N |
| InChI | InChI=1S/C10H14ClNO3/c1-5-2-6(7(11)3-8(5)12)10(15)9(14)4-13/h2-3,9-10,13-15H,4,12H2,1H3 |
| InChIKey | WJNJSNUKMRJPSE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|