C9H16N4O2 — CID 171881061
4-amino-1-(2-amino-4-methylpyrimidin-5-yl)butane-1,2-diol (PubChem CID 171881061) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-amino-1-(2-amino-4-methylpyrimidin-5-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(2-amino-4-methylpyrimidin-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881061 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-amino-1-(2-amino-4-methylpyrimidin-5-yl)butane-1,2-diol |
| SMILES | Cc1nc(N)ncc1C(O)C(O)CCN |
| InChI | InChI=1S/C9H16N4O2/c1-5-6(4-12-9(11)13-5)8(15)7(14)2-3-10/h4,7-8,14-15H,2-3,10H2,1H3,(H2,11,12,13) |
| InChIKey | FRQOBAGJSFFEQE-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |