C10H17N3O2 — CID 171880918
4-amino-1-(5-amino-6-methyl-3-pyridinyl)butane-1,2-diol (PubChem CID 171880918) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-amino-1-(5-amino-6-methyl-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(5-amino-6-methyl-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880918 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-amino-1-(5-amino-6-methyl-3-pyridinyl)butane-1,2-diol |
| SMILES | Cc1ncc(C(O)C(O)CCN)cc1N |
| InChI | InChI=1S/C10H17N3O2/c1-6-8(12)4-7(5-13-6)10(15)9(14)2-3-11/h4-5,9-10,14-15H,2-3,11-12H2,1H3 |
| InChIKey | QFYFPMHYQUAEOQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |