C11H15N3O2 — CID 171881415
4-amino-1-(1H-pyrrolo[3,2-b]pyridin-6-yl)butane-1,2-diol (PubChem CID 171881415) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-amino-1-(1H-pyrrolo[3,2-b]pyridin-6-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(1H-pyrrolo[3,2-b]pyridin-6-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881415 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-amino-1-(1H-pyrrolo[3,2-b]pyridin-6-yl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H15N3O2/c12-3-1-10(15)11(16)7-5-9-8(14-6-7)2-4-13-9/h2,4-6,10-11,13,15-16H,1,3,12H2 |
| InChIKey | CSAJAGLBVNHVGL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |