C9H16N4O2 — CID 171881066
4-amino-1-(6-hydrazinyl-3-pyridinyl)butane-1,2-diol (PubChem CID 171881066) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-amino-1-(6-hydrazinyl-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(6-hydrazinyl-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881066 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-amino-1-(6-hydrazinyl-3-pyridinyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C9H16N4O2/c10-4-3-7(14)9(15)6-1-2-8(13-11)12-5-6/h1-2,5,7,9,14-15H,3-4,10-11H2,(H,12,13) |
| InChIKey | INEIMPNLJHCNHK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|