C11H14N2O3 — CID 171881431
4-amino-1-(1,3-benzoxazol-5-yl)butane-1,2-diol (PubChem CID 171881431) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-amino-1-(1,3-benzoxazol-5-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(1,3-benzoxazol-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881431 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-amino-1-(1,3-benzoxazol-5-yl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C11H14N2O3/c12-4-3-9(14)11(15)7-1-2-10-8(5-7)13-6-16-10/h1-2,5-6,9,11,14-15H,3-4,12H2 |
| InChIKey | MZMOZHZBNJNBMT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |