C13H17NO3 — CID 171881450
6-(4-amino-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one (PubChem CID 171881450) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 6-(4-amino-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one.
| Compound Name | 6-(4-amino-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 171881450 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 6-(4-amino-1,2-dihydroxybutyl)-2,3-dihydroinden-1-one |
| SMILES | NCCC(O)C(O)c1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C13H17NO3/c14-6-5-12(16)13(17)9-2-1-8-3-4-11(15)10(8)7-9/h1-2,7,12-13,16-17H,3-6,14H2 |
| InChIKey | OKHZVICKXJJWPX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |