C13H15ClO4 — CID 171894531
6-(4-chloro-1,2-dihydroxybutyl)-2,3-dihydrochromen-4-one (PubChem CID 171894531) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is 6-(4-chloro-1,2-dihydroxybutyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-(4-chloro-1,2-dihydroxybutyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 171894531 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 6-(4-chloro-1,2-dihydroxybutyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2ccc(C(O)C(O)CCCl)cc21 |
| InChI | InChI=1S/C13H15ClO4/c14-5-3-11(16)13(17)8-1-2-12-9(7-8)10(15)4-6-18-12/h1-2,7,11,13,16-17H,3-6H2 |
| InChIKey | NFHXXBJJYHZJIK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|