C12H11NO4 — CID 171870961
2,3-dihydroxy-3-(4-oxo-2,3-dihydrochromen-6-yl)propanenitrile (PubChem CID 171870961) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-oxo-2,3-dihydrochromen-6-yl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(4-oxo-2,3-dihydrochromen-6-yl)propanenitrile |
|---|---|
| PubChem CID | 171870961 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,3-dihydroxy-3-(4-oxo-2,3-dihydrochromen-6-yl)propanenitrile |
| SMILES | N#CC(O)C(O)c1ccc2c(c1)C(=O)CCO2 |
| InChI | InChI=1S/C12H11NO4/c13-6-10(15)12(16)7-1-2-11-8(5-7)9(14)3-4-17-11/h1-2,5,10,12,15-16H,3-4H2 |
| InChIKey | BAPNAFOFLKLVGC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|