About 6-hydroxysulfanyl-2,3-dihydrochromen-4-one
6-hydroxysulfanyl-2,3-dihydrochromen-4-one (PubChem CID 57099381) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 6-hydroxysulfanyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-hydroxysulfanyl-2,3-dihydrochromen-4-one |
| PubChem CID | 57099381 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 6-hydroxysulfanyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2ccc(SO)cc21 |
| InChI | InChI=1S/C9H8O3S/c10-8-3-4-12-9-2-1-6(13-11)5-7(8)9/h1-2,5,11H,3-4H2 |
| InChIKey | BVFFWTUCLFPQGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxysulfanyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxysulfanyl-2,3-dihydrochromen-4-one?
The IUPAC name of 6-hydroxysulfanyl-2,3-dihydrochromen-4-one (CID 57099381) is 6-hydroxysulfanyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-hydroxysulfanyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-hydroxysulfanyl-2,3-dihydrochromen-4-one is O=C1CCOc2ccc(SO)cc21.
What is the InChIKey of 6-hydroxysulfanyl-2,3-dihydrochromen-4-one?
The InChIKey is BVFFWTUCLFPQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-8-3-4-12-9-2-1-6(13-11)5-7(8)9/h1-2,5,11H,3-4H2.
What are the key properties of 6-hydroxysulfanyl-2,3-dihydrochromen-4-one?
6-hydroxysulfanyl-2,3-dihydrochromen-4-one has a molecular weight of 196.23 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxysulfanyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 57099381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).