C9H8O3S — CID 57099381
6-hydroxysulfanyl-2,3-dihydrochromen-4-one (PubChem CID 57099381) has the molecular formula C9H8O3S and a molecular weight of 196.23 g/mol. Its IUPAC name is 6-hydroxysulfanyl-2,3-dihydrochromen-4-one.
| Compound Name | 6-hydroxysulfanyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 57099381 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 6-hydroxysulfanyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2ccc(SO)cc21 |
| InChI | InChI=1S/C9H8O3S/c10-8-3-4-12-9-2-1-6(13-11)5-7(8)9/h1-2,5,11H,3-4H2 |
| InChIKey | BVFFWTUCLFPQGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|