C13H16O2 — CID 66595033
6-butyl-2,3-dihydrochromen-4-one (PubChem CID 66595033) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-butyl-2,3-dihydrochromen-4-one.
| Compound Name | 6-butyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 66595033 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 6-butyl-2,3-dihydrochromen-4-one |
| SMILES | CCCCc1ccc2c(c1)C(=O)CCO2 |
| InChI | InChI=1S/C13H16O2/c1-2-3-4-10-5-6-13-11(9-10)12(14)7-8-15-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | DKWXBQXFGWHYAY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |