C20H24O2 — CID 57083921
6-hexyl-1,2,3,4-tetrahydroanthracene-9,10-dione (PubChem CID 57083921) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-hexyl-1,2,3,4-tetrahydroanthracene-9,10-dione.
| Compound Name | 6-hexyl-1,2,3,4-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 57083921 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 6-hexyl-1,2,3,4-tetrahydroanthracene-9,10-dione |
| SMILES | CCCCCCc1ccc2c(c1)C(=O)C1=C(CCCC1)C2=O |
| InChI | InChI=1S/C20H24O2/c1-2-3-4-5-8-14-11-12-17-18(13-14)20(22)16-10-7-6-9-15(16)19(17)21/h11-13H,2-10H2,1H3 |
| InChIKey | RPFLEMAESUTYNE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|