C37H33O2P — CID 159934357
2-pentylanthracene-9,10-dione;triphenylphosphane (PubChem CID 159934357) has the molecular formula C37H33O2P and a molecular weight of 540.64 g/mol. Its IUPAC name is 2-pentylanthracene-9,10-dione;triphenylphosphane.
| Compound Name | 2-pentylanthracene-9,10-dione;triphenylphosphane |
|---|---|
| PubChem CID | 159934357 |
| Molecular Formula | C37H33O2P |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 2-pentylanthracene-9,10-dione;triphenylphosphane |
| SMILES | CCCCCc1ccc2c(c1)C(=O)c1ccccc1C2=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18O2.C18H15P/c1-2-3-4-7-13-10-11-16-17(12-13)19(21)15-9-6-5-8-14(15)18(16)20;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h5-6,8-12H,2-4,7H2,1H3;1-15H |
| InChIKey | OAAVEYIWCMYEHG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|