C28H25N3O2 — CID 25011723
2-[[4-(4-pentylphenyl)triazol-1-yl]methyl]anthracene-9,10-dione (PubChem CID 25011723) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[[4-(4-pentylphenyl)triazol-1-yl]methyl]anthracene-9,10-dione.
| Compound Name | 2-[[4-(4-pentylphenyl)triazol-1-yl]methyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 25011723 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[[4-(4-pentylphenyl)triazol-1-yl]methyl]anthracene-9,10-dione |
| SMILES | CCCCCc1ccc(-c2cn(Cc3ccc4c(c3)C(=O)c3ccccc3C4=O)nn2)cc1 |
| InChI | InChI=1S/C28H25N3O2/c1-2-3-4-7-19-10-13-21(14-11-19)26-18-31(30-29-26)17-20-12-15-24-25(16-20)28(33)23-9-6-5-8-22(23)27(24)32/h5-6,8-16,18H,2-4,7,17H2,1H3 |
| InChIKey | XGQKOHFURPOYNY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|