About (2-nonylphenyl)phosphane;triphenylphosphane
(2-nonylphenyl)phosphane;triphenylphosphane (PubChem CID 174888217) has the molecular formula C33H40P2
and a molecular weight of 498.63 g/mol. Its IUPAC name is (2-nonylphenyl)phosphane;triphenylphosphane.
Molecular Properties
| Compound Name | (2-nonylphenyl)phosphane;triphenylphosphane |
| PubChem CID | 174888217 |
| Molecular Formula | C33H40P2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (2-nonylphenyl)phosphane;triphenylphosphane |
| SMILES | CCCCCCCCCc1ccccc1P.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C15H25P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16/h1-15H;9-10,12-13H,2-8,11,16H2,1H3 |
| InChIKey | NRNPEDZEARMDEJ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-nonylphenyl)phosphane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nonylphenyl)phosphane;triphenylphosphane?
The IUPAC name of (2-nonylphenyl)phosphane;triphenylphosphane (CID 174888217) is (2-nonylphenyl)phosphane;triphenylphosphane.
What is the SMILES notation for (2-nonylphenyl)phosphane;triphenylphosphane?
The canonical SMILES for (2-nonylphenyl)phosphane;triphenylphosphane is CCCCCCCCCc1ccccc1P.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (2-nonylphenyl)phosphane;triphenylphosphane?
The InChIKey is NRNPEDZEARMDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C15H25P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16/h1-15H;9-10,12-13H,2-8,11,16H2,1H3.
What are the key properties of (2-nonylphenyl)phosphane;triphenylphosphane?
(2-nonylphenyl)phosphane;triphenylphosphane has a molecular weight of 498.63 g/mol, XLogP of 7.92, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nonylphenyl)phosphane;triphenylphosphane is sourced from PubChem (CID 174888217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).