C18H25NO2 — CID 91233618
5-hexyl-2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 91233618) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 5-hexyl-2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 5-hexyl-2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 91233618 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 5-hexyl-2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | CCCCCCc1ccc2c(c1)C(=O)N(CC(C)C)C2=O |
| InChI | InChI=1S/C18H25NO2/c1-4-5-6-7-8-14-9-10-15-16(11-14)18(21)19(17(15)20)12-13(2)3/h9-11,13H,4-8,12H2,1-3H3 |
| InChIKey | JISCDWOCTHYNSC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|