C14H16O2 — CID 150818824
6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (PubChem CID 150818824) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 150818824 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)=CCc1ccc2c(c1)C(=O)CCO2 |
| InChI | InChI=1S/C14H16O2/c1-10(2)3-4-11-5-6-14-12(9-11)13(15)7-8-16-14/h3,5-6,9H,4,7-8H2,1-2H3 |
| InChIKey | KJMGMRNJODJWHY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|