C12H11BrO2 — CID 169476137
6-(3-bromoprop-1-enyl)-2,3-dihydrochromen-4-one (PubChem CID 169476137) has the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. Its IUPAC name is 6-(3-bromoprop-1-enyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-(3-bromoprop-1-enyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 169476137 |
| Molecular Formula | C12H11BrO2 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 6-(3-bromoprop-1-enyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2ccc(C=CCBr)cc21 |
| InChI | InChI=1S/C12H11BrO2/c13-6-1-2-9-3-4-12-10(8-9)11(14)5-7-15-12/h1-4,8H,5-7H2 |
| InChIKey | UKQNGXRHFWXINL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|