C21H22O2 — CID 139329746
7-[(E)-4-(4-ethylphenyl)but-1-enyl]-2,3-dihydrochromen-4-one (PubChem CID 139329746) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 7-[(E)-4-(4-ethylphenyl)but-1-enyl]-2,3-dihydrochromen-4-one.
| Compound Name | 7-[(E)-4-(4-ethylphenyl)but-1-enyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 139329746 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 7-[(E)-4-(4-ethylphenyl)but-1-enyl]-2,3-dihydrochromen-4-one |
| SMILES | CCc1ccc(CC/C=C/c2ccc3c(c2)OCCC3=O)cc1 |
| InChI | InChI=1S/C21H22O2/c1-2-16-7-9-17(10-8-16)5-3-4-6-18-11-12-19-20(22)13-14-23-21(19)15-18/h4,6-12,15H,2-3,5,13-14H2,1H3/b6-4+ |
| InChIKey | PXIHYOXUUSRENP-GQCTYLIASA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |