C17H11BrO2 — CID 169476439
3-(3-bromoprop-1-enyl)phenanthrene-9,10-dione (PubChem CID 169476439) has the molecular formula C17H11BrO2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 3-(3-bromoprop-1-enyl)phenanthrene-9,10-dione.
| Compound Name | 3-(3-bromoprop-1-enyl)phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 169476439 |
| Molecular Formula | C17H11BrO2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3-(3-bromoprop-1-enyl)phenanthrene-9,10-dione |
| SMILES | O=C1C(=O)c2ccc(C=CCBr)cc2-c2ccccc21 |
| InChI | InChI=1S/C17H11BrO2/c18-9-3-4-11-7-8-14-15(10-11)12-5-1-2-6-13(12)16(19)17(14)20/h1-8,10H,9H2 |
| InChIKey | AORIKQATCSNLPL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|