C19H25NO4 — CID 123869348
N-hydroxy-3-(12-oxo-2-oxabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)prop-2-enamide (PubChem CID 123869348) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is N-hydroxy-3-(12-oxo-2-oxabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)prop-2-enamide.
| Compound Name | N-hydroxy-3-(12-oxo-2-oxabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)prop-2-enamide |
|---|---|
| PubChem CID | 123869348 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-hydroxy-3-(12-oxo-2-oxabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)C(=O)CCCCCCCCCO2)NO |
| InChI | InChI=1S/C19H25NO4/c21-17-8-6-4-2-1-3-5-7-13-24-18-11-9-15(14-16(17)18)10-12-19(22)20-23/h9-12,14,23H,1-8,13H2,(H,20,22) |
| InChIKey | DYAIQJHAPUFYHH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|