C18H14F2O4 — CID 53405064
6-fluoro-2,3-dihydrochromen-4-one;6-fluoro-3,4-dihydrochromen-2-one (PubChem CID 53405064) has the molecular formula C18H14F2O4 and a molecular weight of 332.30 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydrochromen-4-one;6-fluoro-3,4-dihydrochromen-2-one.
| Compound Name | 6-fluoro-2,3-dihydrochromen-4-one;6-fluoro-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 53405064 |
| Molecular Formula | C18H14F2O4 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-fluoro-2,3-dihydrochromen-4-one;6-fluoro-3,4-dihydrochromen-2-one |
| SMILES | O=C1CCOc2ccc(F)cc21.O=C1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/2C9H7FO2/c10-7-2-3-8-6(5-7)1-4-9(11)12-8;10-6-1-2-9-7(5-6)8(11)3-4-12-9/h2-3,5H,1,4H2;1-2,5H,3-4H2 |
| InChIKey | NEPBMFUVWLPBNR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|