C12H12O3 — CID 609166
3,5,6,7-tetrahydro-2H-furo[3,2-h][1]benzoxepin-8-one (PubChem CID 609166) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 3,5,6,7-tetrahydro-2H-furo[3,2-h][1]benzoxepin-8-one.
| Compound Name | 3,5,6,7-tetrahydro-2H-furo[3,2-h][1]benzoxepin-8-one |
|---|---|
| PubChem CID | 609166 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3,5,6,7-tetrahydro-2H-furo[3,2-h][1]benzoxepin-8-one |
| SMILES | O=C1CCCc2cc3c(cc2O1)OCC3 |
| InChI | InChI=1S/C12H12O3/c13-12-3-1-2-8-6-9-4-5-14-10(9)7-11(8)15-12/h6-7H,1-5H2 |
| InChIKey | YCQCEUKVXJPVCP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|