About oxane-2,6-dione;hydrofluoride
oxane-2,6-dione;hydrofluoride (PubChem CID 158320792) has the molecular formula C5H7FO3
and a molecular weight of 134.11 g/mol. Its IUPAC name is oxane-2,6-dione;hydrofluoride.
Molecular Properties
| Compound Name | oxane-2,6-dione;hydrofluoride |
| PubChem CID | 158320792 |
| Molecular Formula | C5H7FO3 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | oxane-2,6-dione;hydrofluoride |
| SMILES | F.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C5H6O3.FH/c6-4-2-1-3-5(7)8-4;/h1-3H2;1H |
| InChIKey | YJZUBKXNVYGIKM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze oxane-2,6-dione;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,6-dione;hydrofluoride?
The IUPAC name of oxane-2,6-dione;hydrofluoride (CID 158320792) is oxane-2,6-dione;hydrofluoride.
What is the SMILES notation for oxane-2,6-dione;hydrofluoride?
The canonical SMILES for oxane-2,6-dione;hydrofluoride is F.O=C1CCCC(=O)O1.
What is the InChIKey of oxane-2,6-dione;hydrofluoride?
The InChIKey is YJZUBKXNVYGIKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.FH/c6-4-2-1-3-5(7)8-4;/h1-3H2;1H.
What are the key properties of oxane-2,6-dione;hydrofluoride?
oxane-2,6-dione;hydrofluoride has a molecular weight of 134.11 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,6-dione;hydrofluoride is sourced from PubChem (CID 158320792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).