About 3-methylfuran;oxane-2,6-dione
3-methylfuran;oxane-2,6-dione (PubChem CID 160731170) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 3-methylfuran;oxane-2,6-dione.
Molecular Properties
| Compound Name | 3-methylfuran;oxane-2,6-dione |
| PubChem CID | 160731170 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-methylfuran;oxane-2,6-dione |
| SMILES | Cc1ccoc1.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C5H6O3.C5H6O/c6-4-2-1-3-5(7)8-4;1-5-2-3-6-4-5/h1-3H2;2-4H,1H3 |
| InChIKey | RUIYAVHLDYZRRX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-methylfuran;oxane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylfuran;oxane-2,6-dione?
The IUPAC name of 3-methylfuran;oxane-2,6-dione (CID 160731170) is 3-methylfuran;oxane-2,6-dione.
What is the SMILES notation for 3-methylfuran;oxane-2,6-dione?
The canonical SMILES for 3-methylfuran;oxane-2,6-dione is Cc1ccoc1.O=C1CCCC(=O)O1.
What is the InChIKey of 3-methylfuran;oxane-2,6-dione?
The InChIKey is RUIYAVHLDYZRRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.C5H6O/c6-4-2-1-3-5(7)8-4;1-5-2-3-6-4-5/h1-3H2;2-4H,1H3.
What are the key properties of 3-methylfuran;oxane-2,6-dione?
3-methylfuran;oxane-2,6-dione has a molecular weight of 196.20 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylfuran;oxane-2,6-dione is sourced from PubChem (CID 160731170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).