About furan-3-ylmethyl butanoate
furan-3-ylmethyl butanoate (PubChem CID 139696747) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is furan-3-ylmethyl butanoate.
Molecular Properties
| Compound Name | furan-3-ylmethyl butanoate |
| PubChem CID | 139696747 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | furan-3-ylmethyl butanoate |
| SMILES | CCCC(=O)OCc1ccoc1 |
| InChI | InChI=1S/C9H12O3/c1-2-3-9(10)12-7-8-4-5-11-6-8/h4-6H,2-3,7H2,1H3 |
| InChIKey | HAXZGXKZPLCGEW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-3-ylmethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-ylmethyl butanoate?
The IUPAC name of furan-3-ylmethyl butanoate (CID 139696747) is furan-3-ylmethyl butanoate.
What is the SMILES notation for furan-3-ylmethyl butanoate?
The canonical SMILES for furan-3-ylmethyl butanoate is CCCC(=O)OCc1ccoc1.
What is the InChIKey of furan-3-ylmethyl butanoate?
The InChIKey is HAXZGXKZPLCGEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-3-9(10)12-7-8-4-5-11-6-8/h4-6H,2-3,7H2,1H3.
What are the key properties of furan-3-ylmethyl butanoate?
furan-3-ylmethyl butanoate has a molecular weight of 168.19 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-ylmethyl butanoate is sourced from PubChem (CID 139696747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).