C12H12O4 — CID 57109918
6-methoxy-2,3,5,6-tetrahydrofuro[3,2-g]chromen-7-one (PubChem CID 57109918) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 6-methoxy-2,3,5,6-tetrahydrofuro[3,2-g]chromen-7-one.
| Compound Name | 6-methoxy-2,3,5,6-tetrahydrofuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 57109918 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 6-methoxy-2,3,5,6-tetrahydrofuro[3,2-g]chromen-7-one |
| SMILES | COC1Cc2cc3c(cc2OC1=O)OCC3 |
| InChI | InChI=1S/C12H12O4/c1-14-11-5-8-4-7-2-3-15-9(7)6-10(8)16-12(11)13/h4,6,11H,2-3,5H2,1H3 |
| InChIKey | ARFFEVFSCUNLSK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|