C13H17NO2 — CID 104871540
N-(3-methoxycyclobutyl)-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 104871540) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-(3-methoxycyclobutyl)-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-(3-methoxycyclobutyl)-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 104871540 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(3-methoxycyclobutyl)-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | COC1CC(Nc2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C13H17NO2/c1-15-12-7-11(8-12)14-10-2-3-13-9(6-10)4-5-16-13/h2-3,6,11-12,14H,4-5,7-8H2,1H3 |
| InChIKey | JZYHOFNHKKVQHQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|